C21H30F3NO2 — CID 11025460
ethyl 2-[benzyl-[(E)-1,1,1-trifluorodec-2-en-4-yl]amino]acetate (PubChem CID 11025460) has the molecular formula C21H30F3NO2 and a molecular weight of 385.47 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(E)-1,1,1-trifluorodec-2-en-4-yl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[(E)-1,1,1-trifluorodec-2-en-4-yl]amino]acetate |
|---|---|
| PubChem CID | 11025460 |
| Molecular Formula | C21H30F3NO2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | ethyl 2-[benzyl-[(E)-1,1,1-trifluorodec-2-en-4-yl]amino]acetate |
| SMILES | CCCCCCC(/C=C/C(F)(F)F)N(CC(=O)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C21H30F3NO2/c1-3-5-6-10-13-19(14-15-21(22,23)24)25(17-20(26)27-4-2)16-18-11-8-7-9-12-18/h7-9,11-12,14-15,19H,3-6,10,13,16-17H2,1-2H3/b15-14+ |
| InChIKey | ZEMBTTLWKUAUPG-CCEZHUSRSA-N |
| XLogP | 5.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|