C19H18FN5O — CID 110255118
[3-[3-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 110255118) has the molecular formula C19H18FN5O and a molecular weight of 351.38 g/mol. Its IUPAC name is [3-[3-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [3-[3-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 110255118 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [3-[3-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CCCC(c2nccnc2-c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H18FN5O/c20-15-5-1-3-13(11-15)17-18(22-9-8-21-17)14-4-2-10-25(12-14)19(26)16-6-7-23-24-16/h1,3,5-9,11,14H,2,4,10,12H2,(H,23,24) |
| InChIKey | LLEAORLURMIHCT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |