About 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one
1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 110256368) has the molecular formula C15H19N5OS
and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| PubChem CID | 110256368 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCC(c2cnc(Nc3nccs3)cn2)C1 |
| InChI | InChI=1S/C15H19N5OS/c1-2-14(21)20-6-3-4-11(10-20)12-8-18-13(9-17-12)19-15-16-5-7-22-15/h5,7-9,11H,2-4,6,10H2,1H3,(H,16,18,19) |
| InChIKey | RUEGJYRLHFQEAA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one?
The IUPAC name of 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one (CID 110256368) is 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one.
What is the SMILES notation for 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one?
The canonical SMILES for 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one is CCC(=O)N1CCCC(c2cnc(Nc3nccs3)cn2)C1.
What is the InChIKey of 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one?
The InChIKey is RUEGJYRLHFQEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5OS/c1-2-14(21)20-6-3-4-11(10-20)12-8-18-13(9-17-12)19-15-16-5-7-22-15/h5,7-9,11H,2-4,6,10H2,1H3,(H,16,18,19).
What are the key properties of 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one?
1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one has a molecular weight of 317.42 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[5-(1,3-thiazol-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one is sourced from PubChem (CID 110256368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).