C18H24N6O — CID 110256839
3-methyl-1-[2-[2-methyl-6-(pyrimidin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 110256839) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-methyl-6-(pyrimidin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[2-[2-methyl-6-(pyrimidin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110256839 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-methyl-1-[2-[2-methyl-6-(pyrimidin-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | Cc1nc(Nc2ncccn2)cc(C2CCCN2C(=O)CC(C)C)n1 |
| InChI | InChI=1S/C18H24N6O/c1-12(2)10-17(25)24-9-4-6-15(24)14-11-16(22-13(3)21-14)23-18-19-7-5-8-20-18/h5,7-8,11-12,15H,4,6,9-10H2,1-3H3,(H,19,20,21,22,23) |
| InChIKey | QNAKCCZPGCFITQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |