About [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone
[3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 110257064) has the molecular formula C15H18N4OS
and a molecular weight of 302.40 g/mol. Its IUPAC name is [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone |
| PubChem CID | 110257064 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CNc1cccc(C2CCCN(C(=O)c3cscn3)C2)n1 |
| InChI | InChI=1S/C15H18N4OS/c1-16-14-6-2-5-12(18-14)11-4-3-7-19(8-11)15(20)13-9-21-10-17-13/h2,5-6,9-11H,3-4,7-8H2,1H3,(H,16,18) |
| InChIKey | XEVXUOREZPZRNV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The IUPAC name of [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone (CID 110257064) is [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone is CNc1cccc(C2CCCN(C(=O)c3cscn3)C2)n1.
What is the InChIKey of [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The InChIKey is XEVXUOREZPZRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4OS/c1-16-14-6-2-5-12(18-14)11-4-3-7-19(8-11)15(20)13-9-21-10-17-13/h2,5-6,9-11H,3-4,7-8H2,1H3,(H,16,18).
What are the key properties of [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone?
[3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone has a molecular weight of 302.40 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[6-(methylamino)-2-pyridinyl]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 110257064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).