C16H22N4 — CID 110257106
5-methyl-2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]pyridine (PubChem CID 110257106) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-methyl-2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]pyridine.
| Compound Name | 5-methyl-2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 110257106 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-methyl-2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]pyridine |
| SMILES | Cc1ccc(C2CCCN(Cc3nccn3C)C2)nc1 |
| InChI | InChI=1S/C16H22N4/c1-13-5-6-15(18-10-13)14-4-3-8-20(11-14)12-16-17-7-9-19(16)2/h5-7,9-10,14H,3-4,8,11-12H2,1-2H3 |
| InChIKey | SQIUIMZHMZEQMO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |