About 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide
5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide (PubChem CID 110257825) has the molecular formula C15H20N6O
and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 110257825 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide |
| SMILES | CNC(=O)c1cn[nH]c1C1CCCN1c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C15H20N6O/c1-9-7-10(2)19-15(18-9)21-6-4-5-12(21)13-11(8-17-20-13)14(22)16-3/h7-8,12H,4-6H2,1-3H3,(H,16,22)(H,17,20) |
| InChIKey | RAPIOWBUSBANPU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide (CID 110257825) is 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide is CNC(=O)c1cn[nH]c1C1CCCN1c1nc(C)cc(C)n1.
What is the InChIKey of 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide?
The InChIKey is RAPIOWBUSBANPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O/c1-9-7-10(2)19-15(18-9)21-6-4-5-12(21)13-11(8-17-20-13)14(22)16-3/h7-8,12H,4-6H2,1-3H3,(H,16,22)(H,17,20).
What are the key properties of 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide?
5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide has a molecular weight of 300.37 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-2-yl]-N-methyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 110257825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).