C14H17N7O — CID 110258416
2-amino-1-[2-[3-(pyrimidin-2-ylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 110258416) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-amino-1-[2-[3-(pyrimidin-2-ylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[2-[3-(pyrimidin-2-ylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110258416 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-amino-1-[2-[3-(pyrimidin-2-ylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCCC1c1nccnc1Nc1ncccn1 |
| InChI | InChI=1S/C14H17N7O/c15-9-11(22)21-8-1-3-10(21)12-13(17-7-6-16-12)20-14-18-4-2-5-19-14/h2,4-7,10H,1,3,8-9,15H2,(H,17,18,19,20) |
| InChIKey | PWXILCCYNLXMSR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |