C16H16N4OS — CID 110258855
[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 110258855) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 110258855 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCCC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C16H16N4OS/c21-16(14-9-22-10-17-14)20-7-3-4-11(8-20)15-18-12-5-1-2-6-13(12)19-15/h1-2,5-6,9-11H,3-4,7-8H2,(H,18,19) |
| InChIKey | VDXKDAYDTYKVEI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |