C18H19N5O2 — CID 110260343
3-ethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 110260343) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-ethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-ethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110260343 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-ethyl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(C3CCc4nncn4C3)cc2)on1 |
| InChI | InChI=1S/C18H19N5O2/c1-2-14-9-16(25-22-14)18(24)20-15-6-3-12(4-7-15)13-5-8-17-21-19-11-23(17)10-13/h3-4,6-7,9,11,13H,2,5,8,10H2,1H3,(H,20,24) |
| InChIKey | ZOZLXQLDEBKCSU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |