C29H40Si — CID 11026123
[(10bS,10cR)-2,7-ditert-butyl-10b,10c-dimethylpyren-4-yl]-trimethylsilane (PubChem CID 11026123) has the molecular formula C29H40Si and a molecular weight of 416.73 g/mol. Its IUPAC name is [(10bS,10cR)-2,7-ditert-butyl-10b,10c-dimethylpyren-4-yl]-trimethylsilane.
| Compound Name | [(10bS,10cR)-2,7-ditert-butyl-10b,10c-dimethylpyren-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11026123 |
| Molecular Formula | C29H40Si |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(10bS,10cR)-2,7-ditert-butyl-10b,10c-dimethylpyren-4-yl]-trimethylsilane |
| SMILES | CC(C)(C)C1=CC2=CC([Si](C)(C)C)=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@@]2(C)[C@]43C |
| InChI | InChI=1S/C29H40Si/c1-26(2,3)21-14-19-12-13-20-15-22(27(4,5)6)17-24-25(30(9,10)11)18-23(16-21)28(19,7)29(20,24)8/h12-18H,1-11H3/t28-,29-/m1/s1 |
| InChIKey | ABSOIZOUOUSSCV-FQLXRVMXSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|