C24H37N3O2 — CID 110262581
4-[[2-(1-acetylpiperidin-3-yl)phenyl]methyl]-1-(2-methylpropyl)piperidine-4-carboxamide (PubChem CID 110262581) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 4-[[2-(1-acetylpiperidin-3-yl)phenyl]methyl]-1-(2-methylpropyl)piperidine-4-carboxamide.
| Compound Name | 4-[[2-(1-acetylpiperidin-3-yl)phenyl]methyl]-1-(2-methylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110262581 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 4-[[2-(1-acetylpiperidin-3-yl)phenyl]methyl]-1-(2-methylpropyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCCC(c2ccccc2CC2(C(N)=O)CCN(CC(C)C)CC2)C1 |
| InChI | InChI=1S/C24H37N3O2/c1-18(2)16-26-13-10-24(11-14-26,23(25)29)15-20-7-4-5-9-22(20)21-8-6-12-27(17-21)19(3)28/h4-5,7,9,18,21H,6,8,10-17H2,1-3H3,(H2,25,29) |
| InChIKey | JFLHPZHJGYRVIW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |