C26H26N4O2 — CID 11026315
5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 11026315) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11026315 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N4O2/c1-18-22(25(27)30-26(28)29-18)14-21-12-13-23(31-16-19-8-4-2-5-9-19)24(15-21)32-17-20-10-6-3-7-11-20/h2-13,15H,14,16-17H2,1H3,(H4,27,28,29,30) |
| InChIKey | GKTPXBIOBMWSEO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |