C26H38OSSi — CID 11026321
tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 11026321) has the molecular formula C26H38OSSi and a molecular weight of 426.74 g/mol. Its IUPAC name is tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11026321 |
| Molecular Formula | C26H38OSSi |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H38OSSi/c1-20(2)25(27-29(7,8)26(4,5)6)21(3)19-24(22-15-11-9-12-16-22)28-23-17-13-10-14-18-23/h9-21,25H,1-8H3/b24-19-/t21-,25+/m0/s1 |
| InChIKey | WTDWBVZPINKZKE-LSSMNVQJSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|