C24H28N4O4 — CID 110263783
3-[6-[1-[2-[2-(2-oxopyrrolidin-1-yl)ethoxy]acetyl]pyrrolidin-2-yl]-3-pyridinyl]benzamide (PubChem CID 110263783) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[6-[1-[2-[2-(2-oxopyrrolidin-1-yl)ethoxy]acetyl]pyrrolidin-2-yl]-3-pyridinyl]benzamide.
| Compound Name | 3-[6-[1-[2-[2-(2-oxopyrrolidin-1-yl)ethoxy]acetyl]pyrrolidin-2-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 110263783 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[6-[1-[2-[2-(2-oxopyrrolidin-1-yl)ethoxy]acetyl]pyrrolidin-2-yl]-3-pyridinyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(C3CCCN3C(=O)COCCN3CCCC3=O)nc2)c1 |
| InChI | InChI=1S/C24H28N4O4/c25-24(31)18-5-1-4-17(14-18)19-8-9-20(26-15-19)21-6-2-11-28(21)23(30)16-32-13-12-27-10-3-7-22(27)29/h1,4-5,8-9,14-15,21H,2-3,6-7,10-13,16H2,(H2,25,31) |
| InChIKey | DAFGAWZBLREJKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|