C24H28F3N3O — CID 11026405
9-[4-(3-aminopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 11026405) has the molecular formula C24H28F3N3O and a molecular weight of 431.50 g/mol. Its IUPAC name is 9-[4-(3-aminopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(3-aminopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 11026405 |
| Molecular Formula | C24H28F3N3O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 9-[4-(3-aminopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C24H28F3N3O/c25-24(26,27)16-29-22(31)23(12-5-6-13-30-14-11-17(28)15-30)20-9-3-1-7-18(20)19-8-2-4-10-21(19)23/h1-4,7-10,17H,5-6,11-16,28H2,(H,29,31) |
| InChIKey | VOEFKZNWKBUQLK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|