C22H34O7Si — CID 11026525
methyl (1aS,4R,4aS,7R,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-7-[(2S)-2-methyloxiran-2-yl]-5-oxo-4,6,7,8-tetrahydronaphtho[1,8a-b]oxirene-4a-carboxylate (PubChem CID 11026525) has the molecular formula C22H34O7Si and a molecular weight of 438.59 g/mol. Its IUPAC name is methyl (1aS,4R,4aS,7R,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-7-[(2S)-2-methyloxiran-2-yl]-5-oxo-4,6,7,8-tetrahydronaphtho[1,8a-b]oxirene-4a-carboxylate.
| Compound Name | methyl (1aS,4R,4aS,7R,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-7-[(2S)-2-methyloxiran-2-yl]-5-oxo-4,6,7,8-tetrahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
|---|---|
| PubChem CID | 11026525 |
| Molecular Formula | C22H34O7Si |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | methyl (1aS,4R,4aS,7R,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-7-[(2S)-2-methyloxiran-2-yl]-5-oxo-4,6,7,8-tetrahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)C[C@@H]([C@@]3(C)CO3)[C@@H](O)[C@@]13O[C@@]3(C)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O7Si/c1-18(2,3)30(7,8)28-15-9-10-20(5)22(29-20)16(24)13(19(4)12-27-19)11-14(23)21(15,22)17(25)26-6/h9-10,13,15-16,24H,11-12H2,1-8H3/t13-,15-,16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | AQUGDVMGMNWADK-OQEKRNBLSA-N |
| XLogP | 2.37 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|