C21H22FN5O2S — CID 110265538
N-[6-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine (PubChem CID 110265538) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[6-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-[6-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 110265538 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[6-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC(c3cccc(Nc4ncccn4)n3)C2)ccc1F |
| InChI | InChI=1S/C21H22FN5O2S/c1-15-13-17(8-9-18(15)22)30(28,29)27-12-3-5-16(14-27)19-6-2-7-20(25-19)26-21-23-10-4-11-24-21/h2,4,6-11,13,16H,3,5,12,14H2,1H3,(H,23,24,25,26) |
| InChIKey | RZPUSXJOMFIHFG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |