C25H33N5O2 — CID 110266504
4-[4-[1-(2-cyclopentylacetyl)piperidin-3-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide (PubChem CID 110266504) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[4-[1-(2-cyclopentylacetyl)piperidin-3-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide.
| Compound Name | 4-[4-[1-(2-cyclopentylacetyl)piperidin-3-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 110266504 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 4-[4-[1-(2-cyclopentylacetyl)piperidin-3-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
| SMILES | CN(C)c1ncc(-c2ccc(C(N)=O)cc2)c(C2CCCN(C(=O)CC3CCCC3)C2)n1 |
| InChI | InChI=1S/C25H33N5O2/c1-29(2)25-27-15-21(18-9-11-19(12-10-18)24(26)32)23(28-25)20-8-5-13-30(16-20)22(31)14-17-6-3-4-7-17/h9-12,15,17,20H,3-8,13-14,16H2,1-2H3,(H2,26,32) |
| InChIKey | OBFPFEVJUHFCCC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |