C27H27N5O — CID 110266511
[3-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]piperidin-1-yl]-isoquinolin-1-ylmethanone (PubChem CID 110266511) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is [3-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]piperidin-1-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [3-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]piperidin-1-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 110266511 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [3-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]piperidin-1-yl]-isoquinolin-1-ylmethanone |
| SMILES | CN(C)c1ncc(-c2ccccc2)c(C2CCCN(C(=O)c3nccc4ccccc34)C2)n1 |
| InChI | InChI=1S/C27H27N5O/c1-31(2)27-29-17-23(19-9-4-3-5-10-19)24(30-27)21-12-8-16-32(18-21)26(33)25-22-13-7-6-11-20(22)14-15-28-25/h3-7,9-11,13-15,17,21H,8,12,16,18H2,1-2H3 |
| InChIKey | WRRJQEQCGSWRRD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |