About 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone
1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 110266718) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 110266718 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(C)ncn2)CC(CO)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-10-5-13(15-9-14-10)17-4-3-16(11(2)19)6-12(7-17)8-18/h5,9,12,18H,3-4,6-8H2,1-2H3 |
| InChIKey | MONDMDYPMGDPQY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (CID 110266718) is 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCN(c2cc(C)ncn2)CC(CO)C1.
What is the InChIKey of 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The InChIKey is MONDMDYPMGDPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-10-5-13(15-9-14-10)17-4-3-16(11(2)19)6-12(7-17)8-18/h5,9,12,18H,3-4,6-8H2,1-2H3.
What are the key properties of 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone has a molecular weight of 264.33 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(hydroxymethyl)-4-(6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 110266718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).