C14H18N4O2 — CID 110266723
1,3-dimethyl-7-piperidin-2-ylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 110266723) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,3-dimethyl-7-piperidin-2-ylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-piperidin-2-ylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110266723 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,3-dimethyl-7-piperidin-2-ylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2ccc(C3CCCCN3)nc2n(C)c1=O |
| InChI | InChI=1S/C14H18N4O2/c1-17-12-9(13(19)18(2)14(17)20)6-7-11(16-12)10-5-3-4-8-15-10/h6-7,10,15H,3-5,8H2,1-2H3 |
| InChIKey | FHYAWLYQJWHDBG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |