C20H14ClF6NO2 — CID 11026735
ethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1-carboxylate (PubChem CID 11026735) has the molecular formula C20H14ClF6NO2 and a molecular weight of 449.78 g/mol. Its IUPAC name is ethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1-carboxylate.
| Compound Name | ethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1-carboxylate |
|---|---|
| PubChem CID | 11026735 |
| Molecular Formula | C20H14ClF6NO2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | ethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)C(F)(F)C(F)(F)Cl)c(-c2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C20H14ClF6NO2/c1-2-30-17(29)14-13-10-6-7-11-28(13)16(12-8-4-3-5-9-12)15(14)18(22,23)19(24,25)20(21,26)27/h3-11H,2H2,1H3 |
| InChIKey | WILIPGWZCRIASX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|