C23H30N6O2S — CID 11026823
tert-butyl N-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]carbamate (PubChem CID 11026823) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 11026823 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | tert-butyl N-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]carbamate |
| SMILES | CN(C)CCn1nc2c3c(c(NCCNC(=O)OC(C)(C)C)ccc31)Sc1ccncc1-2 |
| InChI | InChI=1S/C23H30N6O2S/c1-23(2,3)31-22(30)26-11-10-25-16-6-7-17-19-20(27-29(17)13-12-28(4)5)15-14-24-9-8-18(15)32-21(16)19/h6-9,14,25H,10-13H2,1-5H3,(H,26,30) |
| InChIKey | LZSKTDZCALBQGI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|