C11H16N2O2S — CID 110268312
2-methyl-4-(thiophen-3-ylmethyl)morpholine-2-carboxamide (PubChem CID 110268312) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-methyl-4-(thiophen-3-ylmethyl)morpholine-2-carboxamide.
| Compound Name | 2-methyl-4-(thiophen-3-ylmethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 110268312 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-methyl-4-(thiophen-3-ylmethyl)morpholine-2-carboxamide |
| SMILES | CC1(C(N)=O)CN(Cc2ccsc2)CCO1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(10(12)14)8-13(3-4-15-11)6-9-2-5-16-7-9/h2,5,7H,3-4,6,8H2,1H3,(H2,12,14) |
| InChIKey | XCNFTRUDTUDRNE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |