C23H30N4O3 — CID 110268950
N-cyclopentyl-5-[1-[2-(4-methoxyphenyl)acetyl]piperidin-2-yl]-1H-pyrazole-3-carboxamide (PubChem CID 110268950) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-cyclopentyl-5-[1-[2-(4-methoxyphenyl)acetyl]piperidin-2-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | N-cyclopentyl-5-[1-[2-(4-methoxyphenyl)acetyl]piperidin-2-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110268950 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-cyclopentyl-5-[1-[2-(4-methoxyphenyl)acetyl]piperidin-2-yl]-1H-pyrazole-3-carboxamide |
| SMILES | COc1ccc(CC(=O)N2CCCCC2c2cc(C(=O)NC3CCCC3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-30-18-11-9-16(10-12-18)14-22(28)27-13-5-4-8-21(27)19-15-20(26-25-19)23(29)24-17-6-2-3-7-17/h9-12,15,17,21H,2-8,13-14H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | QDENDQNFOMVYBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |