C20H20N4O2 — CID 110270300
(2-methylpyrazol-3-yl)-[2-(6-phenoxy-2-pyridinyl)pyrrolidin-1-yl]methanone (PubChem CID 110270300) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-[2-(6-phenoxy-2-pyridinyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-methylpyrazol-3-yl)-[2-(6-phenoxy-2-pyridinyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110270300 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2-methylpyrazol-3-yl)-[2-(6-phenoxy-2-pyridinyl)pyrrolidin-1-yl]methanone |
| SMILES | Cn1nccc1C(=O)N1CCCC1c1cccc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O2/c1-23-18(12-13-21-23)20(25)24-14-6-10-17(24)16-9-5-11-19(22-16)26-15-7-3-2-4-8-15/h2-5,7-9,11-13,17H,6,10,14H2,1H3 |
| InChIKey | SGQJWLBVUQNGBZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |