C12H20N4O3S — CID 110270790
4-[3-(1H-pyrazol-5-yl)piperidin-1-yl]sulfonylmorpholine (PubChem CID 110270790) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[3-(1H-pyrazol-5-yl)piperidin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[3-(1H-pyrazol-5-yl)piperidin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 110270790 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[3-(1H-pyrazol-5-yl)piperidin-1-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(N1CCOCC1)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C12H20N4O3S/c17-20(18,15-6-8-19-9-7-15)16-5-1-2-11(10-16)12-3-4-13-14-12/h3-4,11H,1-2,5-10H2,(H,13,14) |
| InChIKey | SUXVLYDFEJXIHW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |