About 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone
1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone (PubChem CID 110271113) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone |
| PubChem CID | 110271113 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2CCC(c3nc(C)cc(C)n3)C2)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-12-10-13(2)19-17(18-12)15-4-7-21(11-15)16-5-8-20(9-6-16)14(3)22/h10,15-16H,4-9,11H2,1-3H3 |
| InChIKey | UKDCNGMECFDUCJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone (CID 110271113) is 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone is CC(=O)N1CCC(N2CCC(c3nc(C)cc(C)n3)C2)CC1.
What is the InChIKey of 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone?
The InChIKey is UKDCNGMECFDUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-12-10-13(2)19-17(18-12)15-4-7-21(11-15)16-5-8-20(9-6-16)14(3)22/h10,15-16H,4-9,11H2,1-3H3.
What are the key properties of 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone?
1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone has a molecular weight of 302.42 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone is sourced from PubChem (CID 110271113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).