C27H29N3O5 — CID 11027170
(1R,3S,4R,6S)-2-azido-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol (PubChem CID 11027170) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is (1R,3S,4R,6S)-2-azido-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol.
| Compound Name | (1R,3S,4R,6S)-2-azido-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11027170 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (1R,3S,4R,6S)-2-azido-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
| SMILES | [N-]=[N+]=NC1C(O)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C27H29N3O5/c28-30-29-22-23(31)25(33-16-19-10-4-1-5-11-19)27(35-18-21-14-8-3-9-15-21)26(24(22)32)34-17-20-12-6-2-7-13-20/h1-15,22-27,31-32H,16-18H2/t22?,23-,24?,25+,26-,27?/m0/s1 |
| InChIKey | ZKISJAKCNPOHHE-JOGXXACESA-N |
| XLogP | 4.16 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|