C14H18N6O2 — CID 110271881
1-[2-(6-amino-2-methylpyrimidin-4-yl)morpholin-4-yl]-2-pyrazol-1-ylethanone (PubChem CID 110271881) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-[2-(6-amino-2-methylpyrimidin-4-yl)morpholin-4-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[2-(6-amino-2-methylpyrimidin-4-yl)morpholin-4-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 110271881 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[2-(6-amino-2-methylpyrimidin-4-yl)morpholin-4-yl]-2-pyrazol-1-ylethanone |
| SMILES | Cc1nc(N)cc(C2CN(C(=O)Cn3cccn3)CCO2)n1 |
| InChI | InChI=1S/C14H18N6O2/c1-10-17-11(7-13(15)18-10)12-8-19(5-6-22-12)14(21)9-20-4-2-3-16-20/h2-4,7,12H,5-6,8-9H2,1H3,(H2,15,17,18) |
| InChIKey | CYZMZFIFUPEBRA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |