About [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone
[6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone (PubChem CID 110272130) has the molecular formula C14H16N4O2S
and a molecular weight of 304.37 g/mol. Its IUPAC name is [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone |
| PubChem CID | 110272130 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cncs1)N1CCOCC(Cc2ccncn2)C1 |
| InChI | InChI=1S/C14H16N4O2S/c19-14(13-6-16-10-21-13)18-3-4-20-8-11(7-18)5-12-1-2-15-9-17-12/h1-2,6,9-11H,3-5,7-8H2 |
| InChIKey | GKIYGBYWFAWDPW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone?
The IUPAC name of [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone (CID 110272130) is [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone.
What is the SMILES notation for [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone?
The canonical SMILES for [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone is O=C(c1cncs1)N1CCOCC(Cc2ccncn2)C1.
What is the InChIKey of [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone?
The InChIKey is GKIYGBYWFAWDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2S/c19-14(13-6-16-10-21-13)18-3-4-20-8-11(7-18)5-12-1-2-15-9-17-12/h1-2,6,9-11H,3-5,7-8H2.
What are the key properties of [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone?
[6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone has a molecular weight of 304.37 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]-(1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 110272130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).