C27H46OS2Si — CID 11027228
ditert-butyl-[(2R,3S)-6-(1,3-dithian-2-yl)-2-methyl-4-methylidene-1-phenylhexan-3-yl]oxy-methylsilane (PubChem CID 11027228) has the molecular formula C27H46OS2Si and a molecular weight of 478.88 g/mol. Its IUPAC name is ditert-butyl-[(2R,3S)-6-(1,3-dithian-2-yl)-2-methyl-4-methylidene-1-phenylhexan-3-yl]oxy-methylsilane.
| Compound Name | ditert-butyl-[(2R,3S)-6-(1,3-dithian-2-yl)-2-methyl-4-methylidene-1-phenylhexan-3-yl]oxy-methylsilane |
|---|---|
| PubChem CID | 11027228 |
| Molecular Formula | C27H46OS2Si |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | ditert-butyl-[(2R,3S)-6-(1,3-dithian-2-yl)-2-methyl-4-methylidene-1-phenylhexan-3-yl]oxy-methylsilane |
| SMILES | C=C(CCC1SCCCS1)[C@@H](O[Si](C)(C(C)(C)C)C(C)(C)C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C27H46OS2Si/c1-21(16-17-24-29-18-13-19-30-24)25(22(2)20-23-14-11-10-12-15-23)28-31(9,26(3,4)5)27(6,7)8/h10-12,14-15,22,24-25H,1,13,16-20H2,2-9H3/t22-,25-/m1/s1 |
| InChIKey | HFKVCOQJHGRDTQ-RCZVLFRGSA-N |
| XLogP | 8.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|