C14H19N5O3S — CID 110272338
[3-methyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 110272338) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is [3-methyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [3-methyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 110272338 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [3-methyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC1(c2[nH]ncc2S(C)(=O)=O)CCCN(C(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C14H19N5O3S/c1-14(12-11(8-16-18-12)23(2,21)22)5-3-7-19(9-14)13(20)10-4-6-15-17-10/h4,6,8H,3,5,7,9H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | GWZGDRZWMYDNPF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |