C15H7NO3 — CID 110272422
1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,3,4-trione (PubChem CID 110272422) has the molecular formula C15H7NO3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,3,4-trione.
| Compound Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,3,4-trione |
|---|---|
| PubChem CID | 110272422 |
| Molecular Formula | C15H7NO3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,3,4-trione |
| SMILES | O=C1C(=O)c2cccc3c4ccccc4n(c23)C1=O |
| InChI | InChI=1S/C15H7NO3/c17-13-10-6-3-5-9-8-4-1-2-7-11(8)16(12(9)10)15(19)14(13)18/h1-7H |
| InChIKey | BBELEMPEOWGWGY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|