C15H7N5O3 — CID 110272474
4-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-2-one (PubChem CID 110272474) has the molecular formula C15H7N5O3 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-2-one.
| Compound Name | 4-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 110272474 |
| Molecular Formula | C15H7N5O3 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-2-one |
| SMILES | [N-]=[N+]=Nc1c([N+](=O)[O-])c(=O)n2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C15H7N5O3/c16-18-17-12-10-6-3-5-9-8-4-1-2-7-11(8)19(13(9)10)15(21)14(12)20(22)23/h1-7H |
| InChIKey | PRMFHWGKYRMRAQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 113.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|