C25H38O9 — CID 11027273
[(2S)-2-[(2S,4S,5R,6R)-2-(3,4-dimethoxyphenyl)-5-methyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]-2-(methoxymethoxy)ethyl] 2,2-dimethylpropanoate (PubChem CID 11027273) has the molecular formula C25H38O9 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(2S)-2-[(2S,4S,5R,6R)-2-(3,4-dimethoxyphenyl)-5-methyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]-2-(methoxymethoxy)ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[(2S,4S,5R,6R)-2-(3,4-dimethoxyphenyl)-5-methyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]-2-(methoxymethoxy)ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11027273 |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(2S)-2-[(2S,4S,5R,6R)-2-(3,4-dimethoxyphenyl)-5-methyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]-2-(methoxymethoxy)ethyl] 2,2-dimethylpropanoate |
| SMILES | COCO[C@@H](COC(=O)C(C)(C)C)[C@H]1O[C@@H](c2ccc(OC)c(OC)c2)O[C@@H]([C@H](C)C=O)[C@H]1C |
| InChI | InChI=1S/C25H38O9/c1-15(12-26)21-16(2)22(20(32-14-28-6)13-31-24(27)25(3,4)5)34-23(33-21)17-9-10-18(29-7)19(11-17)30-8/h9-12,15-16,20-23H,13-14H2,1-8H3/t15-,16-,20+,21+,22+,23+/m1/s1 |
| InChIKey | GTLIJJOXCLCOIP-ZAOUWQRDSA-N |
| XLogP | 3.54 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|