About 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione
3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione (PubChem CID 110272773) has the molecular formula C15H8Cl2N4O2
and a molecular weight of 347.16 g/mol. Its IUPAC name is 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione.
Molecular Properties
| Compound Name | 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione |
| PubChem CID | 110272773 |
| Molecular Formula | C15H8Cl2N4O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione |
| SMILES | [N-]=[N+]=NC1(c2ccccc2)C(=O)Nc2c(Cl)ccc(Cl)c2C1=O |
| InChI | InChI=1S/C15H8Cl2N4O2/c16-9-6-7-10(17)12-11(9)13(22)15(20-21-18,14(23)19-12)8-4-2-1-3-5-8/h1-7H,(H,19,23) |
| InChIKey | LZGNWAFCUVBEHA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione?
The IUPAC name of 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione (CID 110272773) is 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione.
What is the SMILES notation for 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione?
The canonical SMILES for 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione is [N-]=[N+]=NC1(c2ccccc2)C(=O)Nc2c(Cl)ccc(Cl)c2C1=O.
What is the InChIKey of 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione?
The InChIKey is LZGNWAFCUVBEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2N4O2/c16-9-6-7-10(17)12-11(9)13(22)15(20-21-18,14(23)19-12)8-4-2-1-3-5-8/h1-7H,(H,19,23).
What are the key properties of 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione?
3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione has a molecular weight of 347.16 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-5,8-dichloro-3-phenyl-1H-quinoline-2,4-dione is sourced from PubChem (CID 110272773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).