About 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one
2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one (PubChem CID 110272909) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one.
Molecular Properties
| Compound Name | 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one |
| PubChem CID | 110272909 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one |
| SMILES | O=C1C=C(O)SC2=NCCCN12 |
| InChI | InChI=1S/C7H8N2O2S/c10-5-4-6(11)12-7-8-2-1-3-9(5)7/h4,11H,1-3H2 |
| InChIKey | KSBNDWLJYWGRAT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one?
The IUPAC name of 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one (CID 110272909) is 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one.
What is the SMILES notation for 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one?
The canonical SMILES for 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one is O=C1C=C(O)SC2=NCCCN12.
What is the InChIKey of 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one?
The InChIKey is KSBNDWLJYWGRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c10-5-4-6(11)12-7-8-2-1-3-9(5)7/h4,11H,1-3H2.
What are the key properties of 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one?
2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one has a molecular weight of 184.22 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-7,8-dihydro-6H-pyrimido[2,1-b][1,3]thiazin-4-one is sourced from PubChem (CID 110272909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).