About 3-amino-1,2-dihydroquinoline-2,4-diol
3-amino-1,2-dihydroquinoline-2,4-diol (PubChem CID 110273019) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-amino-1,2-dihydroquinoline-2,4-diol.
Molecular Properties
| Compound Name | 3-amino-1,2-dihydroquinoline-2,4-diol |
| PubChem CID | 110273019 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-amino-1,2-dihydroquinoline-2,4-diol |
| SMILES | NC1=C(O)c2ccccc2NC1O |
| InChI | InChI=1S/C9H10N2O2/c10-7-8(12)5-3-1-2-4-6(5)11-9(7)13/h1-4,9,11-13H,10H2 |
| InChIKey | FGSNEDLWIJFHKR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1,2-dihydroquinoline-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,2-dihydroquinoline-2,4-diol?
The IUPAC name of 3-amino-1,2-dihydroquinoline-2,4-diol (CID 110273019) is 3-amino-1,2-dihydroquinoline-2,4-diol.
What is the SMILES notation for 3-amino-1,2-dihydroquinoline-2,4-diol?
The canonical SMILES for 3-amino-1,2-dihydroquinoline-2,4-diol is NC1=C(O)c2ccccc2NC1O.
What is the InChIKey of 3-amino-1,2-dihydroquinoline-2,4-diol?
The InChIKey is FGSNEDLWIJFHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-7-8(12)5-3-1-2-4-6(5)11-9(7)13/h1-4,9,11-13H,10H2.
What are the key properties of 3-amino-1,2-dihydroquinoline-2,4-diol?
3-amino-1,2-dihydroquinoline-2,4-diol has a molecular weight of 178.19 g/mol, XLogP of 0.62, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2-dihydroquinoline-2,4-diol is sourced from PubChem (CID 110273019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).