C16H18NO2S+ — CID 110273026
4-hydroxy-3-(thiolan-1-ium-1-yl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 110273026) has the molecular formula C16H18NO2S+ and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-hydroxy-3-(thiolan-1-ium-1-yl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 4-hydroxy-3-(thiolan-1-ium-1-yl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 110273026 |
| Molecular Formula | C16H18NO2S+ |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-hydroxy-3-(thiolan-1-ium-1-yl)-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | O=c1c([S+]2CCCC2)c(O)c2cccc3c2n1CCC3 |
| InChI | InChI=1S/C16H17NO2S/c18-14-12-7-3-5-11-6-4-8-17(13(11)12)16(19)15(14)20-9-1-2-10-20/h3,5,7H,1-2,4,6,8-10H2/p+1 |
| InChIKey | ICKOLJIKEVLJPD-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|