C13H11ClF2N2O3 — CID 110273775
methyl 6-(chloromethyl)-4-(3,4-difluorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110273775) has the molecular formula C13H11ClF2N2O3 and a molecular weight of 316.69 g/mol. Its IUPAC name is methyl 6-(chloromethyl)-4-(3,4-difluorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 6-(chloromethyl)-4-(3,4-difluorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110273775 |
| Molecular Formula | C13H11ClF2N2O3 |
| Molecular Weight | 316.69 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl 6-(chloromethyl)-4-(3,4-difluorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(CCl)NC(=O)NC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11ClF2N2O3/c1-21-12(19)10-9(5-14)17-13(20)18-11(10)6-2-3-7(15)8(16)4-6/h2-4,11H,5H2,1H3,(H2,17,18,20) |
| InChIKey | GVZSFVJOFRFRRV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|