C18H21N3O2 — CID 110273787
6-cyclohexyl-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 110273787) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 6-cyclohexyl-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 6-cyclohexyl-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 110273787 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 6-cyclohexyl-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)N(C3CCCCC3)C2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C18H21N3O2/c22-17-15-14(11-21(17)13-9-5-2-6-10-13)19-18(23)20-16(15)12-7-3-1-4-8-12/h1,3-4,7-8,13,16H,2,5-6,9-11H2,(H2,19,20,23) |
| InChIKey | ZJDAYLKGOHRHCS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |