C28H34N2O4S — CID 11027424
(2S,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl-2-(phenylmethoxyamino)pent-4-en-1-one (PubChem CID 11027424) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is (2S,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl-2-(phenylmethoxyamino)pent-4-en-1-one.
| Compound Name | (2S,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl-2-(phenylmethoxyamino)pent-4-en-1-one |
|---|---|
| PubChem CID | 11027424 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (2S,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl-2-(phenylmethoxyamino)pent-4-en-1-one |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](NOCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C28H34N2O4S/c1-4-23(21-13-9-6-10-14-21)25(29-34-18-20-11-7-5-8-12-20)26(31)30-24-17-22-15-16-28(24,27(22,2)3)19-35(30,32)33/h4-14,22-25,29H,1,15-19H2,2-3H3/t22-,23+,24-,25+,28-/m1/s1 |
| InChIKey | WOQWFKKCTBJDOS-KAUKRTNFSA-N |
| XLogP | 4.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|