About 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one
8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one (PubChem CID 110275680) has the molecular formula C24H27NO3
and a molecular weight of 377.48 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one.
Molecular Properties
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one |
| PubChem CID | 110275680 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one |
| SMILES | Cc1c(-c2ccccc2)c(=O)oc2c(CN3CC(C)CC(C)C3)c(O)ccc12 |
| InChI | InChI=1S/C24H27NO3/c1-15-11-16(2)13-25(12-15)14-20-21(26)10-9-19-17(3)22(24(27)28-23(19)20)18-7-5-4-6-8-18/h4-10,15-16,26H,11-14H2,1-3H3 |
| InChIKey | TURACDBAQBHKFY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one?
The IUPAC name of 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one (CID 110275680) is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one.
What is the SMILES notation for 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one?
The canonical SMILES for 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one is Cc1c(-c2ccccc2)c(=O)oc2c(CN3CC(C)CC(C)C3)c(O)ccc12.
What is the InChIKey of 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one?
The InChIKey is TURACDBAQBHKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO3/c1-15-11-16(2)13-25(12-15)14-20-21(26)10-9-19-17(3)22(24(27)28-23(19)20)18-7-5-4-6-8-18/h4-10,15-16,26H,11-14H2,1-3H3.
What are the key properties of 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one?
8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one has a molecular weight of 377.48 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-4-methyl-3-phenylchromen-2-one is sourced from PubChem (CID 110275680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).