C26H38N2O8 — CID 11027574
[(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 2-phenylacetate (PubChem CID 11027574) has the molecular formula C26H38N2O8 and a molecular weight of 506.60 g/mol. Its IUPAC name is [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 2-phenylacetate.
| Compound Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 11027574 |
| Molecular Formula | C26H38N2O8 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 2-phenylacetate |
| SMILES | CO[C@@H](C(=O)N[C@H]1CC[C@@H](OC(=O)Cc2ccccc2)CNC1=O)[C@H](O)[C@@H](O)[C@H](O)/C=C/C(C)(C)C |
| InChI | InChI=1S/C26H38N2O8/c1-26(2,3)13-12-19(29)21(31)22(32)23(35-4)25(34)28-18-11-10-17(15-27-24(18)33)36-20(30)14-16-8-6-5-7-9-16/h5-9,12-13,17-19,21-23,29,31-32H,10-11,14-15H2,1-4H3,(H,27,33)(H,28,34)/b13-12+/t17-,18+,19-,21+,22-,23-/m1/s1 |
| InChIKey | OBRPRASYFHNMQE-CFJYATSMSA-N |
| XLogP | 0.24 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|