About [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate
[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate (PubChem CID 11027585) has the molecular formula C31H25NO4S
and a molecular weight of 507.61 g/mol. Its IUPAC name is [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate |
| PubChem CID | 11027585 |
| Molecular Formula | C31H25NO4S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H25NO4S/c1-22(33)36-27-19-17-23(18-20-27)21-28-29(34)32(30(35)37-28)31(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,28H,21H2,1H3 |
| InChIKey | DHIDEWJAINFJON-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate?
The IUPAC name of [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate (CID 11027585) is [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate.
What is the SMILES notation for [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate?
The canonical SMILES for [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate is CC(=O)Oc1ccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1.
What is the InChIKey of [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate?
The InChIKey is DHIDEWJAINFJON-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H25NO4S/c1-22(33)36-27-19-17-23(18-20-27)21-28-29(34)32(30(35)37-28)31(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,28H,21H2,1H3.
What are the key properties of [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate?
[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate has a molecular weight of 507.61 g/mol, XLogP of 6.21, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate is sourced from PubChem (CID 11027585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).