C26H28N2O5 — CID 110276607
3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-(2-pyrrolidin-1-ylethyl)-2H-pyrrol-5-one (PubChem CID 110276607) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-(2-pyrrolidin-1-ylethyl)-2H-pyrrol-5-one.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-(2-pyrrolidin-1-ylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 110276607 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-(2-pyrrolidin-1-ylethyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)/C=C/c3ccco3)=C(O)C(=O)N2CCN2CCCC2)c1 |
| InChI | InChI=1S/C26H28N2O5/c1-2-16-32-21-8-5-7-19(18-21)24-23(22(29)11-10-20-9-6-17-33-20)25(30)26(31)28(24)15-14-27-12-3-4-13-27/h2,5-11,17-18,24,30H,1,3-4,12-16H2/b11-10+ |
| InChIKey | WOYAMYLKNATZJU-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|