C21H23N3O4 — CID 110276797
(4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-methyl-5-(3-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 110276797) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-methyl-5-(3-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-methyl-5-(3-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 110276797 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-methyl-5-(3-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1cccc(C2/C(=C(\O)c3c(C)nn(C)c3C)C(=O)C(=O)N2C)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-6-10-28-15-9-7-8-14(11-15)18-17(20(26)21(27)23(18)4)19(25)16-12(2)22-24(5)13(16)3/h6-9,11,18,25H,1,10H2,2-5H3/b19-17+ |
| InChIKey | PFZDZMLSJRZPTP-HTXNQAPBSA-N |
| XLogP | 2.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|