C31H56N2O2Si — CID 11027688
(Z,2S)-12-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenyldodecan-1-imine (PubChem CID 11027688) has the molecular formula C31H56N2O2Si and a molecular weight of 516.89 g/mol. Its IUPAC name is (Z,2S)-12-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenyldodecan-1-imine.
| Compound Name | (Z,2S)-12-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenyldodecan-1-imine |
|---|---|
| PubChem CID | 11027688 |
| Molecular Formula | C31H56N2O2Si |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 516.41 |
| IUPAC Name | (Z,2S)-12-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenyldodecan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(\c1ccccc1)[C@@H](C)CCCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56N2O2Si/c1-27(20-15-12-10-8-9-11-13-18-25-35-36(6,7)31(2,3)4)30(28-21-16-14-17-22-28)32-33-24-19-23-29(33)26-34-5/h14,16-17,21-22,27,29H,8-13,15,18-20,23-26H2,1-7H3/b32-30-/t27-,29-/m0/s1 |
| InChIKey | COGOPUBEWSQEFL-FXQFLATNSA-N |
| XLogP | 8.67 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|